| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Bromo-2-hydroxy-3-nitro-4-picoline Basic information |
| | 5-Bromo-2-hydroxy-3-nitro-4-picoline Chemical Properties |
| Melting point | 240-243 | | Boiling point | 298.2±40.0 °C(Predicted) | | density | 1.84±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 6.34±0.10(Predicted) | | color | yellow | | InChI | InChI=1S/C6H5BrN2O3/c1-3-4(7)2-8-6(10)5(3)9(11)12/h2H,1H3,(H,8,10) | | InChIKey | QXPNHVCGSASGIX-UHFFFAOYSA-N | | SMILES | C1(=O)NC=C(Br)C(C)=C1[N+]([O-])=O |
| Hazard Codes | Xi | | Hazard Note | Harmful/Irritant/Keep Cold | | HS Code | 2933399990 |
| | 5-Bromo-2-hydroxy-3-nitro-4-picoline Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 5-bromo-4-methyl-3-nitro-2(1H)-pyridinone from 2-amino-5-bromo-3-nitro-4-methylpyridine: to a solution of 5-bromo-4-methyl-3-nitro-pyridin-2-amine (28 g, 121 mmol) in water (900 ml) was slowly added concentrated sulfuric acid (28 ml) at 0 °C, followed by batchwise addition of sodium nitrite (20.91 g, 303 mmol). Water (100 ml) was added dropwise to control the reaction temperature. The reaction mixture was stirred at 0°C and then slowly warmed up to room temperature and kept for 2 hours. Subsequently, the reaction mixture was heated to 100 °C and maintained for 4 hours. Upon completion of the reaction, it was cooled to room temperature, the precipitated solid was collected by filtration, washed with water and dried to afford the target product 5-bromo-4-methyl-3-nitro-2(1H)-pyridinone as a light yellow solid (24.0 g, 85% yield). The product was characterized by 1H NMR (400 MHz, DMSO-d6): δ 12.97 (s, 1H), 8.01 (s, 1H), 2.21 (s, 3H); LC/MS analysis showed m/z 233 ([M+H]+). | | References | [1] Patent: WO2014/125408, 2014, A2. Location in patent: Page/Page column 38 |
| | 5-Bromo-2-hydroxy-3-nitro-4-picoline Preparation Products And Raw materials |
|