|
|
| | 5-Bromo-3-nitro-2-pyridinol Basic information |
| | 5-Bromo-3-nitro-2-pyridinol Chemical Properties |
| Melting point | 246-250 °C | | Boiling point | 296.7±40.0 °C(Predicted) | | density | 1.98±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO, Methanol | | pka | 6.31±0.10(Predicted) | | form | Solid | | color | Yellow | | BRN | 383853 | | InChI | InChI=1S/C5H3BrN2O3/c6-3-1-4(8(10)11)5(9)7-2-3/h1-2H,(H,7,9) | | InChIKey | WXRLCVUDLFFTFF-UHFFFAOYSA-N | | SMILES | C1(=O)NC=C(Br)C=C1[N+]([O-])=O | | CAS DataBase Reference | 15862-34-7(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-37/38-41-36/37/38-20 | | Safety Statements | 26-36/37/39-36 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HS Code | 29337900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 5-Bromo-3-nitro-2-pyridinol Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | 5-Bromo-3-nitropyridin-2(1H)-one is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | | Synthesis | GENERAL METHOD: 2-amino-3-nitro-5-bromopyridine (0.015 mol) was dissolved in 70% sulfuric acid under cooling in an ice bath. A solution prepared from sodium nitrite (1.24 g) dissolved in water (8 mL) was slowly added dropwise in the range of 0-5°C, keeping the reaction temperature constant. After the dropwise addition, the reaction mixture was allowed to warm up gradually to room temperature and stirred continuously at that temperature for 3 hours. After completion of the reaction, the resulting precipitate was separated by filtration, washed well with deionized water and finally dried under vacuum at 60 °C overnight. | | References | [1] Tetrahedron, 2014, vol. 70, # 5, p. 1077 - 1083
[2] Journal of the Chemical Society, 1952, p. 2042,2044
[3] Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 1999, vol. 38, # 9, p. 1036 - 1040 |
| | 5-Bromo-3-nitro-2-pyridinol Preparation Products And Raw materials |
|