- 1,3-DIIODOBENZENE
-
- $1.00
-
2020-01-09
- CAS:626-00-6
- Min. Order: 1ASSAYS
- Purity: 85.0-99.8%
- Supply Ability: 20tons
|
| | 1,3-DIIODOBENZENE Basic information |
| Product Name: | 1,3-DIIODOBENZENE | | Synonyms: | 1,3-diiodo-benzen;Benzene, 1,3-diiodo-;Benzene, m-diiodo-;benzene,1,3-diiodo-;Benzene,m-diiodo-;M-DIIODOBENZENE;1,3-DIIODOBENZENE;1,3-diiodo-benzen、1,3-diiodobenzene、m-Diiodobenzene、1,3-diiodo-benzene、1,3-Dijodbenzol | | CAS: | 626-00-6 | | MF: | C6H4I2 | | MW: | 329.9 | | EINECS: | 210-921-1 | | Product Categories: | Organics;Iodine Compounds;Aryl;Halogenated Hydrocarbons;C6 | | Mol File: | 626-00-6.mol |  |
| | 1,3-DIIODOBENZENE Chemical Properties |
| Melting point | 34-37 °C (lit.) | | Boiling point | 285°C | | density | 2.47 | | refractive index | 1.7179 (estimate) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform, Methanol (Slightly, Heated) | | form | Low Melting Crystalline Mass, Powder or Crystals | | color | Yellow to beige | | Water Solubility | Insoluble in water. Soluble in hot methanol. | | Sensitive | Light Sensitive | | BRN | 1904540 | | InChI | InChI=1S/C6H4I2/c7-5-2-1-3-6(8)4-5/h1-4H | | InChIKey | SFPQFQUXAJOWNF-UHFFFAOYSA-N | | SMILES | C1(I)=CC=CC(I)=C1 | | CAS DataBase Reference | 626-00-6(CAS DataBase Reference) | | EPA Substance Registry System | Benzene, 1,3-diiodo- (626-00-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,3-DIIODOBENZENE Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | suzuki reaction | | Uses | 1,3-Diiodobenzene may be used in the synthesis of:
- 3,5-bis(perfluorodecyl)phenylboronic acid
- epitaxially aligned and separated polyphenylene lines on Cu(110)
- 1,3-bis(4-ethynyl-2,5-dibutoxyphenyl-1-ethynyl)benzene
| | General Description | 1,3-Diiodobenzene is a halogenated benzene derivative. Its reaction with phenylboronic acid in the presence of CuI, DABCO (1,4-diazabicyclo[2.2.2]octane) and TBAB (n-Bu4NBr) has been analyzed. 1,3-Diiodobenzene undergoes coupling with 2-methylthiophene in the presence of Ir/Ag2CO3 to afford meta-linked isomer of thiophene-benzene-thiophene triad. |
| | 1,3-DIIODOBENZENE Preparation Products And Raw materials |
|