| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- Benzoylferrocene
-
-
2025-12-24
- CAS:1272-44-2
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10000KG
|
| | Benzoylferrocene Basic information |
| | Benzoylferrocene Chemical Properties |
| Melting point | 105-107 °C(lit.) | | density | 1.507 g/cm3 | | Water Solubility | Insoluble in water | | form | solid | | color | Orange to Brown | | Exposure limits | ACGIH: TWA 1 mg/m3
NIOSH: TWA 1 mg/m3 | | InChI | InChI=1S/C12H9O.C5H5.Fe/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10;1-2-4-5-3-1;/h1-9H;1-5H; | | InChIKey | JJHHJZCYDPLHIL-UHFFFAOYSA-N | | SMILES | [C]1([CH][CH][CH][CH]1)C(=O)C1=CC=CC=C1.[CH]1[CH][CH][CH][CH]1.[Fe] |^1:0,1,2,3,4,13,14,15,16,17| | | CAS DataBase Reference | 1272-44-2(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoylferrocene(1272-44-2) | | EPA Substance Registry System | Ferrocene, benzoyl- (1272-44-2) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 24/25-37/39-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29319090 | | Storage Class | 13 - Non Combustible Solids |
| | Benzoylferrocene Usage And Synthesis |
| Chemical Properties | red to red-brown powder | | Uses | Intermediate. | | Uses | Reactant for:
- Deprotonative metalation of ferrocenes
- Oxidative chemistry
- Reduction of ferrocenyl ketones
- Polymerization of C-ferrocenyl-substituted phosphaalkene
Reactant for synthesis of:
- Planat chiral triferrocenylmethane derivative
- Chiral ferrocenyl alcohols via asymmetric transfer hydrogenation
| | Hazard | Possibly toxic. | | reaction suitability | core: iron
reagent type: catalyst |
| | Benzoylferrocene Preparation Products And Raw materials |
|