- 1-CYCLOPENTYL-ETHANONE
-
- $9.00 / 1KG
-
2025-05-26
- CAS:6004-60-0
- Min. Order: 1KG
- Purity: 99.8%
- Supply Ability: 100tons
|
| | 1-CYCLOPENTYL-ETHANONE Basic information |
| Product Name: | 1-CYCLOPENTYL-ETHANONE | | Synonyms: | 1-CYCLOPENTYL-ETHANONE;1-Acetylcyclopentane;Acetylcyclopentane;Cyclopentyl(methyl) ketone;ethanone, 1-cyclopentyl-;CYCLOPENTYLETHANONE;1-cyclopentylethanone(SALTDATA: FREE);1-cyclopentylethan-1-one | | CAS: | 6004-60-0 | | MF: | C7H12O | | MW: | 112.17 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 6004-60-0.mol |  |
| | 1-CYCLOPENTYL-ETHANONE Chemical Properties |
| Boiling point | 151-156℃ | | density | 0.913 | | refractive index | 1.4435 | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Water Solubility | Miscible with water. | | InChI | InChI=1S/C7H12O/c1-6(8)7-4-2-3-5-7/h7H,2-5H2,1H3 | | InChIKey | LKENTYLPIUIMFG-UHFFFAOYSA-N | | SMILES | C(=O)(C1CCCC1)C | | LogP | 1.340 (est) | | NIST Chemistry Reference | Ethanone, 1-cyclopentyl-(6004-60-0) |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | HazardClass | IRRITANT | | HS Code | 2914290090 |
| | 1-CYCLOPENTYL-ETHANONE Usage And Synthesis |
| Chemical Properties | Colorless Liquid | | Uses | Cyclopentyl methyl ketone acts as a ligand for Suzuki coupling. Further, it reacts with benzo[1,2,5]oxadiazole 1-oxide to prepare 3-methylspiro(chinoxalin-2(3H),1'-cyclopentan)-3-amin-1,4-dioxide. | | Synthesis Reference(s) | Tetrahedron, 39, p. 3207, 1983 DOI: 10.1016/S0040-4020(01)91568-6 |
| | 1-CYCLOPENTYL-ETHANONE Preparation Products And Raw materials |
|