|
|
| | Isobutyltriphenylphosphonium bromide Basic information |
| Product Name: | Isobutyltriphenylphosphonium bromide | | Synonyms: | histone acetyltransferase HTATIP;HIV-1 Tat interactive protein;Anti-C-PLA2 antibody produced in rabbit;Cytosolic phospholipase A2;PA24;PA24A;PLA2G4;cytosolic phospholipase A2 γ precursor | | CAS: | 22884-29-3 | | MF: | C22H24BrP | | MW: | 399.31 | | EINECS: | 245-291-7 | | Product Categories: | | | Mol File: | 22884-29-3.mol |  |
| | Isobutyltriphenylphosphonium bromide Chemical Properties |
| Melting point | 200-202 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | biological source | rabbit | | Sensitive | Hygroscopic | | BRN | 4171228 | | InChI | InChI=1S/C22H24P.BrH/c1-19(2)18-23(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22;/h3-17,19H,18H2,1-2H3;1H/q+1;/p-1 | | InChIKey | VIKPDPHNYHUZQW-UHFFFAOYSA-M | | SMILES | [P+](C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)CC(C)C.[Br-] | | CAS DataBase Reference | 22884-29-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29310099 | | Storage Class | 10 - Combustible liquids |
| | Isobutyltriphenylphosphonium bromide Usage And Synthesis |
| Chemical Properties | WHITE TO SLIGHTLY YELLOW CRYSTALLINE POWDER | | Uses | Isobutyltriphenylphosphonium Bromide is a useful research intermediate for organic synthesis. It is used in the synthesis of phosphonium salts with antiviral properties. |
| | Isobutyltriphenylphosphonium bromide Preparation Products And Raw materials |
|