| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | alpha-(Cyanoimino)-3,4-dichlorophenethyl -amine, 99% Basic information |
| | alpha-(Cyanoimino)-3,4-dichlorophenethyl -amine, 99% Chemical Properties |
| Melting point | 143-145 °C (lit.) | | Boiling point | 323.4±52.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | pka | -0.85±0.50(Predicted) | | form | solid | | InChI | 1S/C9H7Cl2N3/c10-7-2-1-6(3-8(7)11)4-9(13)14-5-12/h1-3H,4H2,(H2,13,14) | | InChIKey | FPJZOLMBOBRFFS-UHFFFAOYSA-N | | SMILES | N\C(Cc1ccc(Cl)c(Cl)c1)=N/C#N |
| Hazard Codes | C | | Risk Statements | 20/21/22-34 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | 1759 | | WGK Germany | WGK 3 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| | alpha-(Cyanoimino)-3,4-dichlorophenethyl -amine, 99% Usage And Synthesis |
| | alpha-(Cyanoimino)-3,4-dichlorophenethyl -amine, 99% Preparation Products And Raw materials |
|