| Identification | Back Directory | [Name]
Biotin-PEG7-Azide | [CAS]
1334172-75-6 | [Synonyms]
Biotin-PEG7-N3 Biotin-PEG7-Azide Biotin-dPEG??-azide Biotin-PEG7-CH2CH2N3 Biotin-dPEG(R)7-azide α-(2-azidoethyl)-ω-(2-(5-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanamido)ethoxy)hexa(oxyethylene) | [Molecular Formula]
C26H48N6O9S | [MDL Number]
MFCD21363312 | [MOL File]
1334172-75-6.mol | [Molecular Weight]
620.759 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [form ]
solid or viscous liquid | [color ]
Off-white to light yellow | [InChIKey]
WOMFFURCOFOFGG-UHFFFAOYSA-N | [SMILES]
O=C1NC(C2N1)CSC2CCCCC(NCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])=O |
| Hazard Information | Back Directory | [Description]
Biotin-PEG7-azide is PEG-containing click chemistry tool for biotinylation | [Uses]
Biotin-PEG7-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTAC. Biotin-PEG7-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | [reaction suitability]
reaction type: Biotinylations reagent type: cross-linking reagent | [IC 50]
PEGs |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|