| Company Name: |
Guangdong Daxiao Chemical Co., Ltd
|
| Tel: |
1866-171603 18666171603 |
| Email: |
3989665367@qq.com |
| Products Intro: |
Cas:613-94-5
ProductName:Benzoyl hydrazide
Purity: 99.0% | Package: 500G;1KG;25KG;300KG
|
| Company Name: |
Tangyuan Life Science (Shanghai) Co., Ltd
|
| Tel: |
400-618-1121 17316483629 |
| Email: |
sales@townyuan.com |
| Products Intro: |
Cas:613-94-5
ProductName:Benzoyl hydrazine
Purity: 98% | Package: 25kg;180;200kg
|
| Company Name: |
Advanced Chemical Intermediates Ltd.
|
| Tel: |
+44（0）1840 261451 |
| Email: |
enquiries@acints.com |
| Products Intro: |
Cas:613-94-5
ProductName:Benzoic acid hydrazide
Brand: acints | Product Number: ACI-01630 | Purity: 95%+
|
- hydrazide
-
- $1.00
-
2019-07-06
- CAS:32687-78-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | Benzoyl Hydrazide Basic information |
| | Benzoyl Hydrazide Chemical Properties |
| Melting point | 112-114 °C (lit.) | | Boiling point | 250.42°C (rough estimate) | | density | 1.1778 (rough estimate) | | refractive index | 1.5460 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Needle-Like Crystals or Powder | | pka | pK1: 3.03(+2);pK2: 12.45(+1) (25°C) | | color | White to beige | | BRN | 471797 | | InChI | InChI=1S/C7H8N2O/c8-9-7(10)6-4-2-1-3-5-6/h1-5H,8H2,(H,9,10) | | InChIKey | WARCRYXKINZHGQ-UHFFFAOYSA-N | | SMILES | C(NN)(=O)C1=CC=CC=C1 | | CAS DataBase Reference | 613-94-5(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, hydrazide(613-94-5) | | EPA Substance Registry System | Benzoic acid, hydrazide (613-94-5) |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | DH1575000 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 29280090 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Carc. 2
Skin Irrit. 2 | | Hazardous Substances Data | 613-94-5(Hazardous Substances Data) | | Toxicity | LD50 scu-mus: 122 mg/kg JPETAB 122,110,58 |
| | Benzoyl Hydrazide Usage And Synthesis |
| Physical properties | Benzoyl Hydrazide is a carbohydrazide. It is a white to beige needle-like crystals or powder. | | Uses | Benzoyl Hydrazide is used as a chemical intermediate for hydrazine-based products.
| | Side effects | Hepatoxic (a) from occupational exposure (secondary effect) or (b) in animal studies or in humans after ingestion
|
| | Benzoyl Hydrazide Preparation Products And Raw materials |
| Preparation Products | 2-(1-Naphthyl)-5-phenyl-1,3,4-oxadiazole-->2-(4-Bromophenyl)-5-phenyl-1,3,4-oxadiazole-->2-(4-Biphenylyl)-5-phenyl-1,3,4-oxadiazole-->5-(4-Methylphenyl)-1,3,4-oxadiazole-2-thiol-->BOC-D-Phenylalanine-->ZORUBICIN HCL-->benzoylazide-->N'-benzoyl-3-methylbenzohydrazide-->Benzoic acid, ethylidenehydrazide (6CI,7CI,8CI,9CI)-->N'-(1-Amino-2-cyanovinyl)benzenecarbohydrazide |
|