| Company Name: |
Shanghai Amole Biotechnology Co., Ltd.
|
| Tel: |
13370042665 18916960931 |
| Email: |
2596183085@qq.com |
| Products Intro: |
Cas:5593-70-4
ProductName:Titanium butoxide
Purity: 99% | Package: 100g；500g；500mL
|
| Company Name: |
ZHEJIANG MAIGE BIOTECHNOLOGY CO., LTD
|
| Tel: |
4000-156-528 13355733872 |
| Email: |
jsmaige@126.com |
| Products Intro: |
Cas:5593-70-4
ProductName:Titanium Butoxide
Package: 100g | CustNote: Sigma*244112
|
|
| | Titanium Butoxide Basic information |
| | Titanium Butoxide Chemical Properties |
| Melting point | -55°C | | Boiling point | 206 °C/10 mmHg (lit.) | | density | 1.00 g/mL at 20 °C (lit.) | | vapor pressure | 5.6 hPa (20 °C) | | refractive index | n20/D 1.491(lit.) | | Fp | 55 °F | | storage temp. | Store at +2°C to +8°C. | | solubility | Miscible with aliphatic, aromatic, chlorinated and oxygenated solvents. | | form | Liquid | | Specific Gravity | 0.998 | | color | Pale yellow | | explosive limit | 2.0-12.0%(V) | | Water Solubility | RAPIDLY HYDROLIZED | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 4148236 | | Stability: | Stable, but moisture sensitive. Flammable. Incompatible with water, moisture, strong oxidizing agents, strong acids. | | Cosmetics Ingredients Functions | FILM FORMING | | InChI | 1S/4C4H9O.Ti/c4*1-2-3-4-5;/h4*2-4H2,1H3;/q4*-1;+4 | | InChIKey | YHWCPXVTRSHPNY-UHFFFAOYSA-N | | SMILES | CCCCO[Ti](OCCCC)(OCCCC)OCCCC | | LogP | 0.84 at 25℃ | | CAS DataBase Reference | 5593-70-4(CAS DataBase Reference) | | NIST Chemistry Reference | Tetrabutoxytitanium(5593-70-4) | | EPA Substance Registry System | Tetrabutyl titanate (5593-70-4) |
| | Titanium Butoxide Usage And Synthesis |
| Description | Titanium Butoxide is used to prepare nanosized titania in the anatase form and ferroelectric Bi4Ti3O12 thin films.Also, used in the synthesis of nanocrystalline TiO2 powders at room temperature. |
| | Titanium Butoxide Preparation Products And Raw materials |
|