- Glaucocalyxin B
-
- $98.00
-
2026-07-31
- CAS:80508-81-2
- Purity: 99.35%
- Supply Ability: 10g
- glaucocalyxin B
-
- $1.00
-
2020-01-01
- CAS:80508-81-2
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | glaucocalyxin B Basic information |
| Product Name: | glaucocalyxin B | | Synonyms: | glaucocalyxin B;14beta-Acetoxy-7alpha-hydroxy-ent-kaur-16-ene-3,15-dione;Wangzaozin C;Kaur-16-ene-3,15-dione, 14-(acetyloxy)-7-hydroxy-, (7α,14R)-;Inhibitor,Glaucocalyxin B,inhibit,Autophagy | | CAS: | 80508-81-2 | | MF: | C22H30O5 | | MW: | 374.47 | | EINECS: | 200-589-5 | | Product Categories: | | | Mol File: | 80508-81-2.mol |  |
| | glaucocalyxin B Chemical Properties |
| Melting point | 190.5-191℃ | | Boiling point | 509.1±50.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | form | Solid | | pka | 13.42±0.70(Predicted) | | color | White to off-white | | InChIKey | LSUXOKVMORWDLT-VXZLUTCHNA-N | | SMILES | O(C1([H])[C@@H]2CC[C@@]3([H])[C@@]4(CCC(=O)C(C)(C)[C@@]4([H])C[C@@H](O)[C@@]13C(=O)C2=C)C)C(=O)C |&1:3,6,8,16,19,21,r| |
| | glaucocalyxin B Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents. | | Uses | Glaucocalyxin B has anti-platelet aggregation, inhibition of cancer cells. | | target | IC50: 5.86 μM (HL-60 cell Growth) |
| | glaucocalyxin B Preparation Products And Raw materials |
|