|
|
| | 2-Maleimidoethylamine HCl Basic information |
| Product Name: | 2-Maleimidoethylamine HCl | | Synonyms: | N-(2-Aminoethyl)maleimide hydrochloride salt;N-(2-Aminoethyl)maleimidehydrochloride;2-Maleimidoethylamine hydrochloride;N-(2-Aminoethyl)maleimide Hydrochloride;1-(2-Aminoethyl)-1H-pyrrole-2,5-dione HCl;1H-Pyrrole-2,5-dione,1-(2-aminoethyl)-hydrochloride(1:1);2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)ethanaminium chloride;2-amino-ethyl-maleimide hydrochloride | | CAS: | 134272-64-3 | | MF: | C6H9ClN2O2 | | MW: | 176.6 | | EINECS: | | | Product Categories: | | | Mol File: | 134272-64-3.mol |  |
| | 2-Maleimidoethylamine HCl Chemical Properties |
| Melting point | 163 °C(dec.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C6H8N2O2.ClH/c7-3-4-8-5(9)1-2-6(8)10;/h1-2H,3-4,7H2;1H | | InChIKey | NJQOCRDPGFWEKA-UHFFFAOYSA-N | | SMILES | C(N1C(C=CC1=O)=O)CN.Cl | | CAS DataBase Reference | 134272-64-3 |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26 | | HS Code | 2922390090 |
| | 2-Maleimidoethylamine HCl Usage And Synthesis |
| Uses | 2-Maleimidoethylamine Hydrochloride is used in preparation of Maytansinoid-peptide conjugates as therapeutics. |
| | 2-Maleimidoethylamine HCl Preparation Products And Raw materials |
|