- Boc-D-Ala-OH
-
-
2026-08-21
- CAS:7764-95-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- BOC-D-Alanine
-
-
2026-08-21
- CAS:7764-95-6
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 1000kgs
- BOC-D-Alanine
-
- $1.00
-
2026-03-20
- CAS:7764-95-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | BOC-D-Alanine Basic information |
| | BOC-D-Alanine Chemical Properties |
| Melting point | 81-84 °C | | alpha | 26 º (c=2,EtOH) | | Boiling point | 324.46°C (rough estimate) | | density | 1.2321 (rough estimate) | | refractive index | 26 ° (C=2, AcOH) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform, DMSO, Methanol | | pka | 4.02±0.10(Predicted) | | form | Powder | | color | White | | BRN | 2048396 | | Major Application | peptide synthesis | | InChI | InChI=1S/C8H15NO4/c1-5(6(10)11)9-7(12)13-8(2,3)4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m1/s1 | | InChIKey | QVHJQCGUWFKTSE-RXMQYKEDSA-N | | SMILES | C(O)(=O)[C@@H](C)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 7764-95-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29241990 | | Storage Class | 11 - Combustible Solids |
| | BOC-D-Alanine Usage And Synthesis |
| Chemical Properties | white powder | | Uses | N-tert-Boc-D-alanine is an N-Boc-protected form of D-Alanine (A480995). D-Alanine is an amino acid that is commonly found in bacteria, such as Streptococcus faecalis. It is essential for the biosynthesis of peptidoglycan crosslinking sub-units that are used for bacterial cell walls. D-Alanine is also known to cause cytotoxic oxidative stress in brain tumour cells. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-D-Alanine Preparation Products And Raw materials |
|