- Polyporenic acid C
-
-
2024-04-12
- CAS:465-18-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000ton
- Polyporenic acid C
-
-
2023-02-24
- CAS:465-18-9
- Min. Order: 5mg
- Purity: ≥95%(HPLC)
- Supply Ability: 10 g
|
| | 16α-Hydroxy-24-methylene-3-oxo-5α-lanosta-7,9(11)-diene-21-oic acid Basic information |
| Product Name: | 16α-Hydroxy-24-methylene-3-oxo-5α-lanosta-7,9(11)-diene-21-oic acid | | Synonyms: | 16α-Hydroxy-24-methylene-3-oxo-5α-lanosta-7,9(11)-dien-21-oic acid;16α-Hydroxy-24-methylene-3-oxo-5α-lanosta-7,9(11)-diene-21-oic acid;3-Oxo-16α-hydroxy-24-methylene-5α-lanosta-7,9(11)-diene-21-oic acid;16alpha-Hydroxy-24-methylene-3-oxo-5alpha-lanosta-7,9(11)-diene-30-oic acid;Lanosta-7,9(11)-dien-21-oic acid, 16-hydroxy-24-methylene-3-oxo-, (16α)-;(2S)-2-[(10S,13R,14R,16R,17R)-16-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid;cell,Apoptosis,inhibit,Inhibitor,lung,cancer,NSCLC,Polyporenic acid C;Polyporenic acid C, 10 mM in DMSO | | CAS: | 465-18-9 | | MF: | C31H46O4 | | MW: | 482.7 | | EINECS: | | | Product Categories: | Triterpenoids | | Mol File: | 465-18-9.mol |  |
| | 16α-Hydroxy-24-methylene-3-oxo-5α-lanosta-7,9(11)-diene-21-oic acid Chemical Properties |
| Melting point | 265-266℃ | | Boiling point | 620.3±55.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | 4°C, protect from light | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 4.63±0.10(Predicted) | | color | White to off-white | | InChIKey | OWVUHYZGACFYHI-SUIRJFICNA-N | | SMILES | C1(=O)C([C@@]2([H])[C@](C)(CC1)C1C([C@]3([C@@](CC=1)(C)[C@@H]([C@H](C)CCC(=C)C(C)C)[C@H](O)C3)C(O)=O)=CC2)(C)C |&1:3,5,11,12,16,17,26,r| | | CAS DataBase Reference | 465-18-9 |
| | 16α-Hydroxy-24-methylene-3-oxo-5α-lanosta-7,9(11)-diene-21-oic acid Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from Poria cocos. | | Uses | Polyporenic acid C is a lanostane-type triterpenoid isolated from P. cocos. Polyporenic acid C induces cell apoptosis through the death receptor-mediated apoptotic pathway without the involvement of the mitochondria. Polyporenic acid C is promising agent for lung cancer therapy[1]. | | Biological Activity | Polyporenic acid C is a lanostane-type triterpenoid isolated from P. cocos. It induces apoptosis through the death receptor-mediated apoptotic pathway without the involvement of mitochondria. It has the potential to be used in lung cancer research. | | target | PARP | Caspase | PI3K | Akt | p53 | | References | [1] Ling H, et al. Polyporenic acid C induces caspase-8-mediated apoptosis in human lung cancer A549 cells.Mol Carcinog.2009 Jun;48(6):498-507. DOI:10.1002/mc.20487 |
| | 16α-Hydroxy-24-methylene-3-oxo-5α-lanosta-7,9(11)-diene-21-oic acid Preparation Products And Raw materials |
|