|
|
| | 1-(isopropylamino)-3-phenoxy-2-propanol Basic information |
| Product Name: | 1-(isopropylamino)-3-phenoxy-2-propanol | | Synonyms: | 1-(isopropylamino)-3-phenoxy-2-propanol;1-(Isopropylamino)-3-phenoxypropane-2-ol;1-Phenoxy-3-(isopropylamino)-2-propanol;3-Phenoxy-1-(isopropylamino)-2-propanol;1-[(1-Methylethyl)amino]-3-phenoxy-2-propanol;2-Propanol, 1-[(1-Methylethyl)aMino]-3-phenoxy-;IsopropylaMino-3-phenoxy-propan-2-ol;(2RS)-1-[(1-Methylethyl)amino]-3-phenoxypropan-2-ol | | CAS: | 7695-63-8 | | MF: | C12H19NO2 | | MW: | 209.28 | | EINECS: | | | Product Categories: | | | Mol File: | 7695-63-8.mol |  |
| | 1-(isopropylamino)-3-phenoxy-2-propanol Chemical Properties |
| Melting point | 75℃ | | Boiling point | 341.8±27.0 °C(Predicted) | | density | 1.03 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.98±0.20(Predicted) | | color | Off-White | | InChI | InChI=1S/C12H19NO2/c1-10(2)13-8-11(14)9-15-12-6-4-3-5-7-12/h3-7,10-11,13-14H,8-9H2,1-2H3 | | InChIKey | ONXLHKFGTDDVLQ-UHFFFAOYSA-N | | SMILES | C(NC(C)C)C(O)COC1=CC=CC=C1 |
| | 1-(isopropylamino)-3-phenoxy-2-propanol Usage And Synthesis |
| Uses | 1-Isopropylamino-3-phenoxypropan-2-ol is used in the synthesis of enantiomerically pure β-adrenergic blockers. |
| | 1-(isopropylamino)-3-phenoxy-2-propanol Preparation Products And Raw materials |
|