|
|
| | 2-Propanol, 1-[2-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]- Basic information |
| | 2-Propanol, 1-[2-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]- Chemical Properties |
| Melting point | 64 - 66°C | | Boiling point | 398.6±37.0 °C(Predicted) | | density | 1.033 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 13.87±0.20(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical small molecule | | InChI | 1S/C15H25NO3/c1-12(2)16-10-14(17)11-19-15-7-5-4-6-13(15)8-9-18-3/h4-7,12,14,16-17H,8-11H2,1-3H3 | | InChIKey | RQZBCLSVVDPFIC-UHFFFAOYSA-N | | SMILES | N(C(C)C)CC(O)COc1c(cccc1)CCOC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 Repr. 2 |
| | 2-Propanol, 1-[2-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]- Usage And Synthesis |
| Uses | ortho-Metoprolol (Metoprolol EP Impurity E) is a new byproduct detected in Metoprolol tartrate (M338790). |
| | 2-Propanol, 1-[2-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]- Preparation Products And Raw materials |
|