|
|
| | HuMantenidine Basic information |
| Product Name: | HuMantenidine | | Synonyms: | HuMantenidine;14-Hydroxygelsenicine;14-Hydroxyhumantenmine;Kumantenidine;Spiro[3H-indole-3,7'(6'H)-[3,6]methano[3H]oxepino[4,3-b]pyrrol]-2(1H)-one, 2'-ethyl-3'a,4',8',8'a-tetrahydro-9'-hydroxy-1-methoxy-, (3S,3'R,3'aS,6'S,8'aS,9'R)- | | CAS: | 114027-39-3 | | MF: | C19H22N2O4 | | MW: | 342.39 | | EINECS: | | | Product Categories: | | | Mol File: | 114027-39-3.mol |  |
| | HuMantenidine Chemical Properties |
| Boiling point | 513.3±60.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 13.52±0.40(Predicted) | | color | White to off-white | | InChIKey | FLDAHLDTMBMPJD-HCWKNHCHSA-N | | SMILES | N1(OC)C2=C(C=CC=C2)[C@@]2([C@@]3([H])[C@H](O)[C@@]4([H])C(CC)=N[C@@]([H])(C2)[C@@]4([H])CO3)C1=O | | CAS DataBase Reference | 114027-39-3 |
| | HuMantenidine Usage And Synthesis |
| Uses | Humantenidine, an indole alkaloid, is isolated from Gelsemium sempervirens. | | References | [1] Schun Y, et al. Cytotoxic steroids of Gelsemium sempervirens. J Nat Prod. 1987;50(2):195-198. DOI:10.1021/np50050a012 |
| | HuMantenidine Preparation Products And Raw materials |
|