|
|
| | humantenirine Basic information |
| Product Name: | humantenirine | | Synonyms: | humantenirine;4-Demethyl-11-methoxyhumantenine;Spiro[3H-indole-3,8'(7'H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, 3'-ethylidene-1',2',3',4',4'a,5',9',9'a-octahydro-1,6-dimethoxy-, (3S,3'Z,4'R,4'aS,7'R,9'aS)-;Humanlenirine | | CAS: | 82375-30-2 | | MF: | C21H26N2O4 | | MW: | 370.44 | | EINECS: | | | Product Categories: | | | Mol File: | 82375-30-2.mol |  |
| | humantenirine Chemical Properties |
| Boiling point | 531.130±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.302±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 9.197±0.20(predicted) | | InChIKey | ZORKKCARNQAZRJ-WQMYVFALSA-N | | SMILES | N1(OC)C2=C(C=CC(OC)=C2)[C@@]2([C@@]3([H])C[C@@]4([H])/C(=C/C)/CN[C@@]([H])(C2)[C@@]4([H])CO3)C1=O |
| | humantenirine Usage And Synthesis |
| Description | Humantenirine is an oxindole alkaloid that has been shown to have potent inhibition of the enzyme activities. It is a natural product that has been isolated from the plant Humantenia nitens, which is found in Gabon, Africa. Humantenirine has a skeleton similar to other indole alkaloids and contains a hydroxy group on one of the rings. This compound has been shown to be stereoselective and monoterpenoid and may have potential as an anti-inflammatory drug. | | Chemical Properties | Humantenirine ( C21H26N2O4 colorless cubic crystals, mp 168- 169°C, M+ 370.1944). Its UV spectrum is similar to that of gelsemicine; hence both have the same chromophore, 7-methoxy-3,3-disubstituted N-methoxy-oxindole. | | Occurrence | Humantenirine is a natural product found in Gelsemium sempervirens, Gelsemium elegans, and Gelsemium rankinii with data available. | | target | P450 (e.g. CYP17) |
| | humantenirine Preparation Products And Raw materials |
|