- Humantenmine
-
- $40.00
-
2026-07-23
- CAS:82354-38-9
- Purity: 99.36%
- Supply Ability: 10g
- Humantenmine
-
-
2023-02-24
- CAS:82354-38-9
- Min. Order: 5mg
- Purity: ≥96%(HPLC)
- Supply Ability: 10 g
- humantenmine
-
- $8.00
-
2020-02-21
- CAS:82354-38-9
- Min. Order: 1g
- Purity: ＞98% HPLC
|
| | humantenmine Basic information |
| Product Name: | humantenmine | | Synonyms: | humantenmine;Spiro[3H-indole-3,7'(6'H)-[3,6]methano[3H]oxepino[4,3-b]pyrrol]-2(1H)-one, 2'-ethyl-3'a,4',8',8'a-tetrahydro-1-methoxy-, (3S,3'R,3'aS,6'R,8'aS)-;Humantenmine, 10 mM in DMSO | | CAS: | 82354-38-9 | | MF: | C19H22N2O3 | | MW: | 326.39 | | EINECS: | | | Product Categories: | Alkaloids | | Mol File: | 82354-38-9.mol |  |
| | humantenmine Chemical Properties |
| Boiling point | 463.6±55.0 °C(Predicted) | | density | 1.44±0.1 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Cryst. | | pka | 7.17±0.20(Predicted) | | color | Off-white to light yellow | | InChI | InChI=1S/C19H22N2O3/c1-3-14-11-8-17-19(9-15(20-14)12(11)10-24-17)13-6-4-5-7-16(13)21(23-2)18(19)22/h4-7,11-12,15,17H,3,8-10H2,1-2H3/t11-,12+,15+,17-,19+/m1/s1 | | InChIKey | BIGABVPVCRHEES-NWPJSNQLSA-N | | SMILES | N1(OC)C2=C(C=CC=C2)[C@@]2([C@@]3([H])C[C@@]4([H])C(CC)=N[C@@]([H])(C2)[C@@]4([H])CO3)C1=O |
| | humantenmine Usage And Synthesis |
| Chemical Properties | Colorless block crystal (acetone), melting point 166 ~ 168℃, soluble in benzene, chloroform and alcohols and other organic solvents. | | Biological Activity | Humantenmine, an alkaloid isolated from Chinese nematode, has potential for pain and rheumatoid arthritis. | | in vitro | Humantenmine (HMT) decreases the 14-day survival rate of the mice to 17% after they are intragastrically treated with HMT, along with hepatic injury and increasing alanine aminotransferase (ALT)/aspartate aminotransferase (AST) levels. CYP3A4/5 mediates the metabolism and detoxification of HMT. | | target | P450 (e.g. CYP17) |
| | humantenmine Preparation Products And Raw materials |
|