- 4-Bromo-3-fluorophenol
-
- $5.00
-
2026-07-03
- CAS:121219-03-2
- Min. Order: 1kg
- Purity: ≥98%
- Supply Ability: 100mt/year
|
| | 4-Bromo-3-fluorophenol Basic information |
| | 4-Bromo-3-fluorophenol Chemical Properties |
| Melting point | 71.5 °C | | Boiling point | 75°C/1mm | | density | 1.764±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 8.40±0.18(Predicted) | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C6H4BrFO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H | | InChIKey | MRQYTJXVULSNIS-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(Br)C(F)=C1 | | CAS DataBase Reference | 121219-03-2(CAS DataBase Reference) |
| | 4-Bromo-3-fluorophenol Usage And Synthesis |
| Chemical Properties | White to pale yellow crystals | | Uses | 3-Fluoro-4-bromophenol is a phenolic organic compound, which can be used as a fluorine-containing organic intermediate, and can be used for the synthesis of medicines, pesticides, dyes, etc. |
| | 4-Bromo-3-fluorophenol Preparation Products And Raw materials |
|