|
|
| | 3-Amino-5-fluorobenzotrifluoride Basic information |
| Product Name: | 3-Amino-5-fluorobenzotrifluoride | | Synonyms: | 3-AMINO-5-FLUOROBENZOTRIFLUORIDE;3-FLUORO-5-(TRIFLUOROMETHYL)ANILINE;3-AMINO-5-FLUORO-TRIFLUOROMETHYLBENZENE;3-Amino-5-fluorobenzotrifluoride 98%;3-Amino-5-fluorobenzotrifluoride98%;3-TriMethyl-5-fluoroaniline;3-Fluoro-5-(trifluoromethyl)aniline, alpha,alpha,alpha,5-Tetrafluoro-m-toluidine;3-AMino-5-fluorobenzotrifluoride[3-fluoro-5-(trifluoroMethyl)aniline] | | CAS: | 454-67-1 | | MF: | C7H5F4N | | MW: | 179.11 | | EINECS: | | | Product Categories: | | | Mol File: | 454-67-1.mol |  |
| | 3-Amino-5-fluorobenzotrifluoride Chemical Properties |
| Boiling point | 186.8±40.0 °C(Predicted) | | density | 1.383±0.06 g/cm3(Predicted) | | Fp | 75 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 2.36±0.10(Predicted) | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C7H5F4N/c8-5-1-4(7(9,10)11)2-6(12)3-5/h1-3H,12H2 | | InChIKey | WQKQODZOQAFYPR-UHFFFAOYSA-N | | SMILES | C1(N)=CC(C(F)(F)F)=CC(F)=C1 | | CAS DataBase Reference | 454-67-1(CAS DataBase Reference) |
| | 3-Amino-5-fluorobenzotrifluoride Usage And Synthesis |
| | 3-Amino-5-fluorobenzotrifluoride Preparation Products And Raw materials |
|