|
|
| | 4-Nitrophenyl octyl ether Basic information |
| Product Name: | 4-Nitrophenyl octyl ether | | Synonyms: | P-NITROPHENYL OCTYL ETHER;P-(OCTYLOXY)NITROBENZENE;1-Nitro-4-(octyloxy)benzene;4-NITROPHENYLOCTYLETHER,98%;4-(OCTYLOXY)NITROBENZENE;4-NITROPHENYL OCTYL ETHER 99%;1-(Octyloxy)-4-nitrobenzene;4-Octyloxy-1-nitrobenzene | | CAS: | 49562-76-7 | | MF: | C14H21NO3 | | MW: | 251.32 | | EINECS: | | | Product Categories: | | | Mol File: | 49562-76-7.mol |  |
| | 4-Nitrophenyl octyl ether Chemical Properties |
| Boiling point | 225-227 °C (20 mmHg) | | density | 1.0696 (rough estimate) | | refractive index | 1.527-1.529 | | Fp | 38 °C | | storage temp. | Flammables area | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C14H21NO3/c1-2-3-4-5-6-7-12-18-14-10-8-13(9-11-14)15(16)17/h8-11H,2-7,12H2,1H3 | | InChIKey | WTTNDGCMXADGCJ-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=CC=C(OCCCCCCCC)C=C1 | | CAS DataBase Reference | 49562-76-7 |
| Risk Statements | 10 | | Safety Statements | 16 | | HS Code | 29093090 |
| Provider | Language |
|
ACROS
| English |
| | 4-Nitrophenyl octyl ether Usage And Synthesis |
| Chemical Properties | clear yellow liquid after melting |
| | 4-Nitrophenyl octyl ether Preparation Products And Raw materials |
|