- 3-(Trifluoromethoxy)nitrobenzene
-
- $200.00 / 1KG
-
2025-09-25
- CAS:2995-45-1
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 3-(Trifluoromethoxy)nitrobenzene Basic information |
| Product Name: | 3-(Trifluoromethoxy)nitrobenzene | | Synonyms: | m-nitrotrifluoromethoxybenzene;3-(trifluoromrthoxy)nitrobebzene;m-trifluoromethoxynitrobenzene;1-nitro-3-(trifluoromethoxy)benzene;3-(TRIFLUOROMETHOXY)NITROBENZENE;3-(Trifluoromethoxy)nitrobenzene 97%;3-(Trifluoromethoxy)nitrobenzene97%;1-Nitro-3-(trifluoromethoxy)benzene> | | CAS: | 2995-45-1 | | MF: | C7H4F3NO3 | | MW: | 207.11 | | EINECS: | | | Product Categories: | | | Mol File: | 2995-45-1.mol |  |
| | 3-(Trifluoromethoxy)nitrobenzene Chemical Properties |
| Boiling point | 240-242 °C(lit.) | | density | 1.391 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.502(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C7H4F3NO3/c8-7(9,10)14-6-3-1-2-5(4-6)11(12)13/h1-4H | | InChIKey | QBWJNDOQIAARBT-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=CC=CC(OC(F)(F)F)=C1 | | CAS DataBase Reference | 2995-45-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2909309090 |
| | 3-(Trifluoromethoxy)nitrobenzene Usage And Synthesis |
| | 3-(Trifluoromethoxy)nitrobenzene Preparation Products And Raw materials |
|