| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | DL-Alanine-13C3 Basic information |
| | DL-Alanine-13C3 Chemical Properties |
| Melting point | 289 °C (dec.) (lit.) | | form | solid | | InChI | 1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/i1+1,2+1,3+1 | | InChIKey | QNAYBMKLOCPYGJ-VMIGTVKRSA-N | | SMILES | [13CH3][13CH](N)[13C](O)=O | | CAS Number Unlabeled | 302-72-7 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DL-Alanine-13C3 Usage And Synthesis |
| | DL-Alanine-13C3 Preparation Products And Raw materials |
|