| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | (R)-1-[(1S)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldicyclohexylphosphine Basic information | | Reaction |
| Product Name: | (R)-1-[(1S)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldicyclohexylphosphine | | Synonyms: | (R)-(-)-1-[(S)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldicyclohexylphosphine,min. 97%;(R)1[(1S)2(di-C-hexylphosphino)ferrocen. ]et-dicyclohexylphos;(R)-(-)-1-[(S)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldicyclohexylphosphine,min.97%;(r,r)-1-dicyclohexylphosphino-2-[1-(dicyclohexylphosphino)ethyl]ferrocene (acc to cas);(R)-(-)-1-[(S)-2-(DICYCLOHEXYLPHOSPHINO)FERROCENYL]ETHYLDICYCLOHEXYLPHOSPHINE;(R,R)-1-DICYCLOHEXYLPHOSPHINO-2-[1-(DICYCLOHEXYLPHOSPHINO)ETHYL]FERROCENE;(R)-1-[(SP)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldicyclohexylphosphine;Josiphos SL-J003-1 /(R)-1-[(SP)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldicyclohexylphosphine | | CAS: | 167416-28-6 | | MF: | C36H50FeP2 | | MW: | 600.59 | | EINECS: | | | Product Categories: | Chiral Phosphine;Ferrocene Series;Josiphos Series;organophosphine ligand | | Mol File: | 167416-28-6.mol | ![(R)-1-[(1S)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldicyclohexylphosphine Structure](CAS/GIF/167416-28-6.gif) |
| | (R)-1-[(1S)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldicyclohexylphosphine Chemical Properties |
| alpha | -139° ±4° (c 0.5, CHCl3) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | orange | | InChIKey | LVJMXQBMWBNENE-KHZPMNTOSA-N | | SMILES | [Fe].[CH]1[CH][CH][CH][CH]1.C[C@H]([C]2[CH][CH][CH][C]2P(C3CCCCC3)C4CCCCC4)P(C5CCCCC5)C6CCCCC6 | | CAS DataBase Reference | 167416-28-6 |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | F | 1-10 | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids |
| | (R)-1-[(1S)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldicyclohexylphosphine Usage And Synthesis |
| Reaction |
- Ligand for Pd-catalyzed C-N cross-coupling
- Ligand for Rh-catalyzed C-N cross-coupling
- Ligand for Pd-catalyzed asymmetric synthesis of (S)-QUINAP via dynamic kinetic resolution
- Ligand for Ni-catalyzed monoarylation of ammonia
| | General Description | sold in collaboration with Solvias AG |
| | (R)-1-[(1S)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldicyclohexylphosphine Preparation Products And Raw materials |
|