- (R)-(S)-JOSIPHOS
-
- $2.00
-
2026-07-02
- CAS:155806-35-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | (R)-(S)-JOSIPHOS Basic information |
| Product Name: | (R)-(S)-JOSIPHOS | | Synonyms: | (R)-1-[(SP)-2-(Diphenylphosphino)ferrocenyl]ethyldicyclohexylphosphine >=97%;(R,R)-2-(1-(Dicyclohexylphosphino)ethyl)-1-(diphenylphosphino)ferrocene;(R)-1-[(SP)-2-(Diphenylphos;"Josiphos SL-J001-1/ (R)-1-[(SP)-2-(Diphenylphosphino)ferrocenyl]ethyldicyclohexylphosphine";(R)-1-[(SP)-2-(Diphenylphosphino)ferrocenyl]ethyldicyclohexylphosphine 95%;(R)-(-)-1-[(S)-2-(Diphenylphosphino)ferrocenyl]ethyldicyclohexylphosphineethanoladduct,min.97%(R)-(S)-JOSIPHOS;(r,r)-1-[1-(dicyclohexylphosphino)ethyl]-2-o-(diphenylphosphino)ferrocene (acc to cas);(R)-(S)-Josiphos, Josiphos SL-J001-1, (2R)-1-[(1R)-1-(Dicyclohexylphosphino)ethyl]-2-(diphenylphosphino)ferrocene (acc to CAS) | | CAS: | 155806-35-2 | | MF: | C36H44FeP210* | | MW: | 594.53 | | EINECS: | | | Product Categories: | organophosphine ligand;Chiral Phosphine;Ferrocene Series;Josiphos Series | | Mol File: | 155806-35-2.mol |  |
| | (R)-(S)-JOSIPHOS Chemical Properties |
| Melting point | ~95 °C (dec.) | | alpha | -360° (c 0.5, CHCl3) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Crystals or Crystalline Powder | | color | White | | Stability: | store cold | | InChIKey | HGTBZFMPHBAUCQ-IGHQBCTINA-N | | SMILES | P(C1=CC=CC=C1)(C1C=CC=CC=1)[C]1[CH][CH][CH][C]1[C@@H](C)P(C1CCCCC1)C1CCCCC1.[CH]1[CH][CH][CH][CH]1.[Fe] |&1:18,r,^1:13,14,15,16,17,33,34,35,36,37| |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29319090 |
| | (R)-(S)-JOSIPHOS Usage And Synthesis |
| Chemical Properties | orange crystalline powder | | Uses | It may be used in the preparation of cyclopentadienyliridium complexes, [IrCl(PP)]2 and [IrCp(PP)]. (Cp= cyclopentadienyl; PP= (R)-1-[(SP)-2-(diphenylphosphino)ferrocenyl]ethyldicyclohexylphosphine) | | General Description | sold in collaboration with Solvias AG |
| | (R)-(S)-JOSIPHOS Preparation Products And Raw materials |
|