Thalidomide-NH-PEG2-C2-NH2 hydrochloride manufacturers
|
| | Thalidomide-NH-PEG2-C2-NH2 hydrochloride Basic information |
| Product Name: | Thalidomide-NH-PEG2-C2-NH2 hydrochloride | | Synonyms: | Thalidomide-NH-PEG2-C2-NH2 hydrochloride;Pomalidomide 4’-PEG2-amine;Pomalidomide-NH-PEG2-amine hydrochloride;Thalidomide-NH-PEG2-NH2 HCl;Thalidomide-PEG2-C2-NH2 hydrochloride;Pomalidomide 4'-PEG2-amine hydrochloride;1H-Isoindole-1,3(2H)-dione, 4-[[2-[2-(2-aminoethoxy)ethoxy]ethyl]amino]-2-(2,6-dioxo-3-piperidinyl), 4-[[2-[2-(2-Aminoethoxy)ethoxy]ethyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione | | CAS: | 2245697-87-2 | | MF: | C19H25ClN4O6 | | MW: | 440.88 | | EINECS: | | | Product Categories: | | | Mol File: | 2245697-87-2.mol |  |
| | Thalidomide-NH-PEG2-C2-NH2 hydrochloride Chemical Properties |
| storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | form | Solid | | color | Light yellow to green yellow | | InChIKey | KFHRVSOIOPAUND-UHFFFAOYSA-N | | SMILES | O=C1NC(C(CC1)N2C(C3=C(C2=O)C(NCCOCCOCCN)=CC=C3)=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Thalidomide-NH-PEG2-C2-NH2 hydrochloride Usage And Synthesis |
| Uses | Thalidomide-PEG2-C2-NH2 hydrochloride is a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and 2-unit PEG linker used in PROTAC technology[1]. | | IC 50 | Cereblon | | storage | Store at -20°C | | References | [1] Wang Z, et al. Proteolysis Targeting Chimeras for the Selective Degradation of Mcl-1/Bcl-2 Derived from Nonselective Target Binding Ligands. J Med Chem. 2019 Sep 12;62(17):8152-8163. DOI:10.1021/acs.jmedchem.9b00919 |
| | Thalidomide-NH-PEG2-C2-NH2 hydrochloride Preparation Products And Raw materials |
|