|
|
| | L-Lysine S-(carboxymethyl)-L-cysteine Basic information |
| Product Name: | L-Lysine S-(carboxymethyl)-L-cysteine | | Synonyms: | L-Lysine S-(carboxymethyl)-L-cysteine;L-lysine, compound with S-(carboxymethyl)-L-cysteine (1:1);S-Carboxymethyl-L-cysteine lysinate;L-Lysine S-(carboxymethyl)-L-cysteine (1:1);(R)-2-Amino-3-((carboxymethyl)thio)propanoic acid (S)-2,6-diaminohexanoic acid (1:1);(2R)-2-amino-3-(carboxymethylsulfanyl)propanoic acid,(2S)-2,6-diaminohexanoic acid;2-amino-3-(carboxymethylthio)propanoic acid;(R)-2-Amino-3-((carboxymethyl)thio)propanoic acid compound with (S)-2,6-diaminohexanoic acid (1:1) | | CAS: | 49673-81-6 | | MF: | C11H23N3O6S | | MW: | 325.38 | | EINECS: | 256-425-9 | | Product Categories: | amino acid | | Mol File: | 49673-81-6.mol |  |
| | L-Lysine S-(carboxymethyl)-L-cysteine Chemical Properties |
| density | 1.274[at 20℃] | | storage temp. | 2-8°C | | Water Solubility | 965.6g/L at 20℃ | | Cosmetics Ingredients Functions | SKIN CONDITIONING
HAIR WAVING OR STRAIGHTENING | | InChI | InChI=1/C6H14N2O2.C5H9NO4S/c7-4-2-1-3-5(8)6(9)10;6-3(5(9)10)1-11-2-4(7)8/h5H,1-4,7-8H2,(H,9,10);3H,1-2,6H2,(H,7,8)(H,9,10)/t5-;3-/s3 | | InChIKey | SAGXGPWVLUSDSQ-GGIGNUEINA-N | | SMILES | [C@@H](N)(C(=O)O)CCCCN.C(SCC(=O)O)[C@H](N)C(=O)O |&1:0,16,r| |
| | L-Lysine S-(carboxymethyl)-L-cysteine Usage And Synthesis |
| Uses | Fluifort is used in anti-cancer treatment as a selective scavenger of reactive oxygen intermediates. | | Flammability and Explosibility | Not classified |
| | L-Lysine S-(carboxymethyl)-L-cysteine Preparation Products And Raw materials |
|