|
|
| | 4-Amino-6-chloropyrimidin-5-ylamine Basic information |
| | 4-Amino-6-chloropyrimidin-5-ylamine Chemical Properties |
| Melting point | 252 °C (decomp) | | Boiling point | 336.7±37.0 °C(Predicted) | | density | 1.565 | | Fp | 157℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | powder to crystal | | pka | 2.39±0.10(Predicted) | | color | White to Amber to Dark green | | λmax | 305nm(lit.) | | Stability: | Hygroscopic | | InChI | InChI=1S/C4H5ClN4/c5-3-2(6)4(7)9-1-8-3/h1H,6H2,(H2,7,8,9) | | InChIKey | VNSFICAUILKARD-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=C(N)C(N)=N1 | | CAS DataBase Reference | 4316-98-7 | | EPA Substance Registry System | 4,5-Pyrimidinediamine, 6-chloro- (4316-98-7) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | TSCA | TSCA listed | | HS Code | 29335990 |
| | 4-Amino-6-chloropyrimidin-5-ylamine Usage And Synthesis |
| Chemical Properties | Light yellow solid | | Uses | 4-Amino-6-chloropyrimidin-5-ylamine is a chlorinated diaminopyrimidine used in the preparation of various bioactive choloropurine derivatives. | | Synthesis | Step 1: 4,6-Dichloropyrimidin-5-amine (1.64 g, 10 mmol) was suspended in 5 mL of concentrated hydrochloric acid. The suspension was transferred to a sealed tube, ammonia solution was added and the reaction was stirred at 100 °C overnight. Upon completion of the reaction, the solid product was collected by filtration and dried under vacuum to afford the target compound 6-chloropyrimidine-4,5-diamine as a yellow solid (1.2 g, 83% yield).LC-MS analysis showed m/z 145 ([M+H]+). | | References | [1] Patent: WO2006/46023, 2006, A1. Location in patent: Page/Page column 115-116 [2] Patent: WO2008/75110, 2008, A1. Location in patent: Page/Page column 116 [3] Patent: WO2007/125315, 2007, A2. Location in patent: Page/Page column 115 [4] Patent: WO2007/125325, 2007, A1. Location in patent: Page/Page column 92-93 [5] Organic Process Research and Development, 2011, vol. 15, # 4, p. 841 - 854 |
| | 4-Amino-6-chloropyrimidin-5-ylamine Preparation Products And Raw materials |
|