|
|
| | 5-Bromo-6-chloro-3-indolyl-beta-D-galactoside Basic information |
| Product Name: | 5-Bromo-6-chloro-3-indolyl-beta-D-galactoside | | Synonyms: | RED-GAL;MAGENTA(TM)-BETA-D-GAL;MAGENTA(TM)-BETA-D-GALACTOSIDE;MAGENTA-GAL;5-BROMO-6-CHLORO-3-INDOLYL-BETA-D-GALACTOPYRANOSIDE;5-BROMO-6-CHLORO-3-INDOLYL-BETA-D-GALACTOSIDE;5-BROMO-6-CHLORO-3-INDOXYL-BETA-D-GALACTOPYRANOSIDE;5-Bromo-6-chloro-3-indolyl beta-D-Galactopyranoside (contains ca. 10% Ethyl Acetate) [for Biochemical Research] | | CAS: | 93863-88-8 | | MF: | C14H15BrClNO6 | | MW: | 408.63 | | EINECS: | 679-549-9 | | Product Categories: | substrate | | Mol File: | 93863-88-8.mol |  |
| | 5-Bromo-6-chloro-3-indolyl-beta-D-galactoside Chemical Properties |
| Boiling point | 673.9±55.0 °C(Predicted) | | density | 1.882±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | methanol: soluble | | pka | 12.78±0.70(Predicted) | | form | powder | | color | White to Light yellow | | BRN | 1552602 | | InChI | InChI=1/C14H15BrClNO6/c15-6-1-5-8(2-7(6)16)17-3-9(5)22-14-13(21)12(20)11(19)10(4-18)23-14/h1-3,10-14,17-21H,4H2/t10-,11+,12+,13-,14-/s3 | | InChIKey | XVRKAVAGZMOBNO-CKIKVBCHSA-N | | SMILES | C12C=C(C(Cl)=CC=1NC=C2O[C@H]1[C@H](O)[C@H]([C@@H](O)[C@@H](CO)O1)O)Br |&1:11,12,14,15,17,r| | | CAS DataBase Reference | 93863-88-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | 5-Bromo-6-chloro-3-indolyl-beta-D-galactoside Usage And Synthesis |
| Chemical Properties | White to off-white crystalline powder | | Uses | 5-Bromo-6-chloro-3-indolyl-β-D-galactopyranoside is a chromogenic substrate for β-Galactosidase, producing a red or magenta insoluble product. |
| | 5-Bromo-6-chloro-3-indolyl-beta-D-galactoside Preparation Products And Raw materials |
|