|
|
| | 5-Bromo-3-indolyl-beta-D-galactopyranoside Basic information |
| Product Name: | 5-Bromo-3-indolyl-beta-D-galactopyranoside | | Synonyms: | beta-d-galactopyranoside,5-bromo-1h-indol-3-yl;5-BROMOINDOLYL B-D-GALACTOPYRANOSIDEMOLE CULAR BIOL;5-BROMO-3-INDOLYL-B-D-GALACTOSIDE;5-Bromo-3-indolyl-b-D-galactopyranoside;5-bromo-3-indolyl-beta-galactoside;5-BROMO-3-INDOLYL-BETA-D -GALACTOPYRANOSIDE 98+% -20 C;5-BROMO-3-INDOLYL-BETA-D -GALACTOPYRANOSIDE MOLECULAR BIOLOGY GRADE 98+% -20 C;BLUE GAL (5-BROMO-3-INDOLYL- BETA-D-GALACTOPYRANOSIDE) | | CAS: | 97753-82-7 | | MF: | C14H16BrNO6 | | MW: | 374.18 | | EINECS: | 1533716-785-6 | | Product Categories: | substrate;Indoles and derivatives | | Mol File: | 97753-82-7.mol |  |
| | 5-Bromo-3-indolyl-beta-D-galactopyranoside Chemical Properties |
| Melting point | 195 °C | | alpha | -34.5 º (c=1% in DMF/H2O 1:1) | | Boiling point | 646.6±55.0 °C(Predicted) | | density | 1.824±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMF: soluble | | form | Powder | | pka | 12.82±0.70(Predicted) | | color | White | | Optical Rotation | [α]20/D 34.5±2.0°, c = 1% in DMF/H2O 1:1 | | Water Solubility | Soluble in dimethylformamide (100 mg/ml), dimethylformamide/water (1:1 v/v) (10 mg/ml - clear, practically colorless solution). | | BRN | 1550140 | | InChI | 1S/C14H16BrNO6/c15-6-1-2-8-7(3-6)9(4-16-8)21-14-13(20)12(19)11(18)10(5-17)22-14/h1-4,10-14,16-20H,5H2/t10-,11+,12+,13-,14-/m1/s1 | | InChIKey | LINMATFDVHBYOS-MBJXGIAVSA-N | | SMILES | OC[C@H]1O[C@@H](Oc2c[nH]c3ccc(Br)cc23)[C@H](O)[C@@H](O)[C@H]1O | | CAS DataBase Reference | 97753-82-7(CAS DataBase Reference) |
| | 5-Bromo-3-indolyl-beta-D-galactopyranoside Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | 5-Bromo-3-indolyl-beta-D-galactopyranoside is a substrate for beta-galactosidase that is converted, by the enzyme, into an insoluble indigoblue chromophore. It is also used in Lac gene detection systems, in immunoblotting and immunocytochemical assays. | | Uses | 5-Bromo-3-indolyl-β-D-galactopyranoside is an α-galactosidase substrate which is converted to an insoluble indigo-blue chromophore darker than that released by X-GAL. It is ideal for Lac gene detection systems in immunoblotting, immunocytochemical, and histological applications. Also used as chromogenic substrate that is suitable for identification of lac-(+) bacterial colonies. |
| | 5-Bromo-3-indolyl-beta-D-galactopyranoside Preparation Products And Raw materials |
|