| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Fmoc-L-Glu-ODmab Basic information |
| Product Name: | Fmoc-L-Glu-ODmab | | Synonyms: | (S)-4-(((9H-fluoren-9-yl)methyl9H-fluoren-9-yl)methoxy)carbonylamino)-5-(4-(1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3-methylbutylamino)benzyloxy)-5-oxopentanoic acid;Fmoc-L-glutamic acid alpha-4-[N-{1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3-methylbutyl}amino]benzyl ester;Fmoc-L-Glu-ODmab;Fmoc-L-glutamic acid-a-4-[N-{1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3-methylbutyl}amino] benzyl ester≥ 98% (HPLC);N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-glutamic acid 1-[[4-[[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3-methylbutyl]amino]phenyl]methyl] ester;(4S)-5-[(4-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3-methylbutyl]amino}phenyl)methoxy]-4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-oxopentanoic acid;FMOC-GLU-ODMAB 5 G;L-Glutamic acid, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, 1-[[4-[[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)-3-methylbutyl]amino]phenyl]methyl] ester | | CAS: | 172611-75-5 | | MF: | C40H44N2O8 | | MW: | 680.79 | | EINECS: | | | Product Categories: | | | Mol File: | 172611-75-5.mol |  |
| | Fmoc-L-Glu-ODmab Chemical Properties |
| Boiling point | 854.7±65.0 °C(Predicted) | | density | 1.251 | | storage temp. | Store at -15°C to -25°C. | | pka | 4.45±0.10(Predicted) | | form | powder | | Major Application | peptide synthesis | | InChIKey | DABQNXPVTHIRRK-UHFFFAOYSA-N | | SMILES | N(C(CCC(=O)OCc4ccc(cc4)NC(=C5C(=O)CC(CC5=O)(C)C)CC(C)C)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-L-Glu-ODmab Usage And Synthesis |
| Chemical Properties | Yellow powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-L-Glu-ODmab Preparation Products And Raw materials |
|