|
|
| | 3-Trifluoromethoxyphenylacetic acid Chemical Properties |
| Melting point | 53-55°C | | Boiling point | 260.2±35.0 °C(Predicted) | | density | 1.399±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 4.10±0.10(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C9H7F3O3/c10-9(11,12)15-7-3-1-2-6(4-7)5-8(13)14/h1-4H,5H2,(H,13,14) | | InChIKey | NFZQVADYFXRRPM-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=CC(OC(F)(F)F)=C1 | | CAS DataBase Reference | 203302-97-0(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 3-Trifluoromethoxyphenylacetic acid Usage And Synthesis |
| Uses | 3-Trifluoromethoxyphenylacetic acid is an organic intermediate that can be used to prepare analgesic compounds and glutaminase inhibitors. | | Application | 3-Trifluoromethoxyphenylacetic acid can be used to prepare 3-(dimethylaminomethyl)piperidine-4-ol derivatives having the following structure. These compounds can be used to treat or improve diseases related to opioid receptors. These diseases can be selected from, but are not limited to, pain, gastrointestinal disorders, and depression. For example, pain can be selected from, but is not limited to, centrally mediated pain, peripherally mediated pain, pain related to structural or soft tissue injury, inflammation-related pain, pain related to progressive diseases, neuropathic pain, acute pain, and chronic pain. | | Chemical Properties | White solid |
| | 3-Trifluoromethoxyphenylacetic acid Preparation Products And Raw materials |
|