|
|
| | 2,3-DICHLORO-5,8-DIHYDROXY-1,4-NAPHTHOQUINONE Basic information |
| Product Name: | 2,3-DICHLORO-5,8-DIHYDROXY-1,4-NAPHTHOQUINONE | | Synonyms: | 2,3-DICHLORO-5,8-DIHYDROXY-1,4-NAPHTHOQUINONE;2,3-DICHLORO-5,8-DIHYDROXY-1,4-NAPHTOQUINONE;RARECHEM AR PA 0036;2,3-DICHLORO-5,8-DIHYDROXY-1,4-NAPHTOQUINONE 95+%;2,3-DICHLORO-5,8-DIHYDROXY-1,4-NAPTHOQUINONE;2,3-Dichloro-5,8-dihydroxy-1,4-naphthoquinone ,95%;2,3-Dichloro-5,8-dihydroxy-1,4-naphthoquinone 95%;tert-butyl (5-carbamoylthiazol-2-yl)carbamate | | CAS: | 14918-69-5 | | MF: | C10H4Cl2O4 | | MW: | 259.04 | | EINECS: | | | Product Categories: | Alcohols;Monomers;Polymer Science;Anthraquinones, Hydroquinones and Quinones | | Mol File: | 14918-69-5.mol |  |
| | 2,3-DICHLORO-5,8-DIHYDROXY-1,4-NAPHTHOQUINONE Chemical Properties |
| Melting point | 197-199 °C (lit.) | | Boiling point | 366.21°C (rough estimate) | | density | 1.5311 (rough estimate) | | refractive index | 1.5110 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly) | | pka | 5.84±0.20(Predicted) | | form | powder to crystal | | color | Orange to Brown to Dark red | | InChI | 1S/C10H4Cl2O4/c11-7-8(12)10(16)6-4(14)2-1-3(13)5(6)9(7)15/h1-2,13-14H | | InChIKey | UVESKDKGJSABKP-UHFFFAOYSA-N | | SMILES | Oc1ccc(O)c2C(=O)C(Cl)=C(Cl)C(=O)c12 | | CAS DataBase Reference | 14918-69-5(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2914.79.4000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3-DICHLORO-5,8-DIHYDROXY-1,4-NAPHTHOQUINONE Usage And Synthesis |
| Chemical Properties | DARK PURPLE POWDER |
| | 2,3-DICHLORO-5,8-DIHYDROXY-1,4-NAPHTHOQUINONE Preparation Products And Raw materials |
|