- Boc-Lys(AC)
-
-
2026-07-09
- CAS:6404-26-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- BOC-LYS(AC)-OH
-
- $15.00
-
2021-08-12
- CAS:6404-26-8
- Min. Order: 1KG
- Purity: 99%+ HPLC
- BOC-LYS(AC)-OH
-
- $1.00
-
2019-07-06
- CAS:6404-26-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | BOC-LYS(AC)-OH Basic information |
| | BOC-LYS(AC)-OH Chemical Properties |
| Melting point | 137-138 °C | | Boiling point | 528.8±45.0 °C(Predicted) | | density | 1.124±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.99±0.21(Predicted) | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | 1S/C13H24N2O5/c1-9(16)14-8-6-5-7-10(11(17)18)15-12(19)20-13(2,3)4/h10H,5-8H2,1-4H3,(H,14,16)(H,15,19)(H,17,18)/t10-/m0/s1 | | InChIKey | IOKOUUAPSRCSNT-JTQLQIEISA-N | | SMILES | N([C@@H](CCCCNC(=O)C)C(=O)O)C(=O)OC(C)(C)C | | CAS DataBase Reference | 6404-26-8(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HS Code | 2924190090 | | Storage Class | 11 - Combustible Solids |
| | BOC-LYS(AC)-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-LYS(AC)-OH Preparation Products And Raw materials |
|