- Boc-L-Thr(tBu)-OH
-
- $0.00/ kg
-
2026-03-27
- CAS:13734-40-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | Boc-O-tert-butyl-L-threonine Basic information |
| | Boc-O-tert-butyl-L-threonine Chemical Properties |
| Melting point | 95-98 °C | | Boiling point | 391.3±37.0 °C(Predicted) | | density | 1.070±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in DMF. | | pka | 3.53±0.10(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | [α]20/D +3.6±0.5°, c = 2% in DMF | | BRN | 4454820 | | Major Application | peptide synthesis | | InChI | 1S/C13H25NO5/c1-8(18-12(2,3)4)9(10(15)16)14-11(17)19-13(5,6)7/h8-9H,1-7H3,(H,14,17)(H,15,16)/t8-,9+/m1/s1 | | InChIKey | LKRXXARJBFBMCE-BDAKNGLRSA-N | | SMILES | C[C@@H](OC(C)(C)C)[C@H](NC(=O)OC(C)(C)C)C(O)=O | | CAS DataBase Reference | 13734-40-2(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924 19 00 | | Storage Class | 11 - Combustible Solids |
| | Boc-O-tert-butyl-L-threonine Usage And Synthesis |
| Uses | N-Boc-O-tert-butyl-L-threonine is used as pharmaceutical intermediate. | | General Description | Boc-Thr(t-Bu)-OH (N-Boc-O-tert-butyl-L-threonine) participates in the synthesis of 2,3-unsaturated glycosides, via reaction with per-O-acetylated glucal in the presence of Er(OTf)3 catalyst. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-O-tert-butyl-L-threonine Preparation Products And Raw materials |
|