| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Boc-L-beta-homoleucine Basic information |
| | Boc-L-beta-homoleucine Chemical Properties |
| Melting point | 53-55℃ | | Boiling point | 374.3±25.0 °C(Predicted) | | density | 1.046±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Very slightly soluble (1.1 g/L at 25°C). | | pka | 4.45±0.10(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | BRN | 4251252 | | Major Application | peptide synthesis | | InChI | 1S/C12H23NO4/c1-8(2)6-9(7-10(14)15)13-11(16)17-12(3,4)5/h8-9H,6-7H2,1-5H3,(H,13,16)(H,14,15)/t9-/m0/s1 | | InChIKey | XRVAMBSTOWHUMM-VIFPVBQESA-N | | SMILES | CC(C)C[C@@H](CC(O)=O)NC(=O)OC(C)(C)C | | CAS DataBase Reference | 132549-43-0 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29241990 | | Storage Class | 11 - Combustible Solids |
| | Boc-L-beta-homoleucine Usage And Synthesis |
| Chemical Properties | White powder or off-white solid | | Uses | (S)-3-(Boc-amino)-5-methylhexanoic acid is used as building blocks for the synthesis of "carba peptides" and building block for β-peptides. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-L-beta-homoleucine Preparation Products And Raw materials |
|