- Cbz-L-Tyr-OH
-
- $0.00/ kg
-
2026-01-23
- CAS:1164-16-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Z-TYR-OH
-
- $0.00 / 1KG
-
2025-12-24
- CAS:1164-16-5
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10 tons
- Z-TYR-OH
-
- $15.00 / 1KG
-
2021-08-12
- CAS:1164-16-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Z-TYR-OH Basic information |
| | Z-TYR-OH Chemical Properties |
| Melting point | 57-60 °C(lit.) | | Boiling point | 454.88°C (rough estimate) | | density | 1.1781 (rough estimate) | | refractive index | 10.0 ° (C=1, AcOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetic Acid (Sparingly), DMSO (Slightly), Methanol (Sparingly) | | pka | 2.97±0.10(Predicted) | | form | Solid | | color | Off-White | | Optical Rotation | [α]22/D +11°, c = 1 in acetic acid | | Water Solubility | 1.53g/L(25 ºC) | | BRN | 2169918 | | Major Application | peptide synthesis | | InChI | 1S/C17H17NO5.H2O/c19-14-8-6-12(7-9-14)10-15(16(20)21)18-17(22)23-11-13-4-2-1-3-5-13;/h1-9,15,19H,10-11H2,(H,18,22)(H,20,21);1H2/t15-;/m0./s1 | | InChIKey | BBPCQKGWAVVMSL-RSAXXLAASA-N | | SMILES | O=C(N[C@H](C(O)=O)CC1=CC=C(O)C=C1)OCC2=CC=CC=C2 | | CAS DataBase Reference | 1164-16-5(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | Z-TYR-OH Usage And Synthesis |
| Chemical Properties | Beige powder | | Uses | N-Cbz-L-tyrosine is an N-Cbz-protected form of L-Tyrosine (T899975). L-Tyrosine is an essential amino acid that exhibits in vitro antioxidant and antiradical activities. L-Tyrosine is used as a precursor to synthesize catecholamines (e.g. Norepinephrine HCl [N674500]) in human keratinocytes, and also for the synthesis of proteins and thyroid hormones. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Z-TYR-OH Preparation Products And Raw materials |
|