|
|
| | 4-Chloro-3-cyanopyridine Basic information |
| Product Name: | 4-Chloro-3-cyanopyridine | | Synonyms: | 4-CHLORO-NICOTINONITRILE;4-CHLORO-3-CYANOPYRIDINE;4-Chloro-pyridin-3-carbonitrile;3-Pyridinecarbonitrile,4-chloro-;4-Chloro-3-pyridinecarbonitrile;4-Chloropyridine-3-carbonitrile;Nicotinonitrile,4-Chloro-(7CI);4-CHLORO-3-CYANOPYRIDINE 98% | | CAS: | 89284-61-7 | | MF: | C6H3ClN2 | | MW: | 138.55 | | EINECS: | | | Product Categories: | Heterocyclic Compounds | | Mol File: | 89284-61-7.mol |  |
| | 4-Chloro-3-cyanopyridine Chemical Properties |
| Melting point | 86 °C | | Boiling point | 243.6±20.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 1.11±0.10(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C6H3ClN2/c7-6-1-2-9-4-5(6)3-8/h1-2,4H | | InChIKey | QBKPXDUZFDINDV-UHFFFAOYSA-N | | SMILES | C1=NC=CC(Cl)=C1C#N | | CAS DataBase Reference | 89284-61-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 4-Chloro-3-cyanopyridine Usage And Synthesis |
| Uses | 4-Chloro-3-cyanopyridine is used in the preparation of heteroaryl urea inhibitors. | | Uses | 4-Chloro-3-pyridinecarbonitrile is used in the preparation of heteroaryl urea inhibitors. |
| | 4-Chloro-3-cyanopyridine Preparation Products And Raw materials |
|