|
|
| | 2,6-Difluorobenzyl chloride Basic information |
| | 2,6-Difluorobenzyl chloride Chemical Properties |
| Melting point | 34-38 °C(lit.) | | Boiling point | 172-173°C 640mm | | density | 1.2730 (estimate) | | Fp | 151 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Soluble), Methanol (Slightly) | | form | Solid | | color | White to Off-White Waxy | | Water Solubility | Soluble in acetone, DMSO and DMF. Insoluble in water. | | Sensitive | Lachrymatory | | BRN | 243793 | | InChI | InChI=1S/C7H5ClF2/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 | | InChIKey | MJXRENZUAQXZGJ-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(F)=C1CCl | | CAS DataBase Reference | 697-73-4(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34-20/22 | | Safety Statements | 26-36/37/39-45-60-20 | | RIDADR | UN 1759 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2,6-Difluorobenzyl chloride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 2,6-Difluorobenzyl chloride is used as rufinamide intermediate. It is an important raw material and intermediate used in organic synthesis. | | General Description | Gaseous chlorine reacts with 2,6-difluorotoluene to yield 2,6-difluorobenzyl chloride. |
| | 2,6-Difluorobenzyl chloride Preparation Products And Raw materials |
|