- Amidosulfuron
-
- $1.00 / 1KG
-
2020-01-10
- CAS:120923-37-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200KG
|
| Product Name: | Amidosulfuron | | Synonyms: | AMIDOSULFURON;Amidosulfuron PESTANAL;GRATIL;n-(((((4,6-dimethoxy-2-pyrimidinyl)amino)carbonyl)amino)sulfonyl)-n-methylmethanesulfonamide;METHYLMETHANESULFONAMIDE;1-(4,6-Dimethoxypyrimidin-2-yl)-3-(N-mesyl-N-methylsulfamoyl)urea;Amidosulfuron [iso];3,5-Dithia-2,4-diazahexanaMide,N-(4,6-diMethoxy-2-pyriMidinyl)-4-Methyl-, 3,3,5,5-tetraoxide | | CAS: | 120923-37-7 | | MF: | C9H15N5O7S2 | | MW: | 369.37 | | EINECS: | 407-380-0 | | Product Categories: | | | Mol File: | 120923-37-7.mol |  |
| | Amidosulfuron Chemical Properties |
| Melting point | 160-163°C | | density | 1.594±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 0.12±0.40(Predicted) | | color | White to Off-White | | Henry's Law Constant | 6.4×105 mol/(m3Pa) at 25℃, Maniere et al. (2011) | | Stability: | Hygroscopic, Unstable in Solution | | Major Application | agriculture environmental | | InChI | 1S/C9H15N5O7S2/c1-14(22(4,16)17)23(18,19)13-9(15)12-8-10-6(20-2)5-7(11-8)21-3/h5H,1-4H3,(H2,10,11,12,13,15) | | InChIKey | CTTHWASMBLQOFR-UHFFFAOYSA-N | | SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)n1 | | LogP | 1.630 | | CAS DataBase Reference | 120923-37-7(CAS DataBase Reference) |
| Risk Statements | 52/53 | | Safety Statements | 61 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| | Amidosulfuron Usage And Synthesis |
| Description | Amidosulfuron is a broad spectrum herbicide that is used to control broad-leaved weeds. It is volatile, highly soluble in water and, based on its chemical properties, has a high potential for leaching to groundwater. It is not persistent in soil systems but may be persistent in water under certain conditions. | | Toxicity | Amidosulfuron has a low mammalian toxicity and would not be expected to bioaccumulate. Amidosulfuron is moderately toxic to most terrestrial and aquatic species. | | Uses | Herbicide. | | Uses | Amidosulfuron, is used as pesticide and herbicides. | | Definition | ChEBI: Amidosulfuron is an aromatic ether. | | Metabolic pathway | The hydrolysis of 14C-amidosulfuron in buffer aqueous
solutions under various conditions results in 2-amino-
4,6-dimethoxypyrimidine as the major hydrolyzed
product. In soils, O-demethylated amidosulfuron is the
major degradation product. In mammals and plants,
primary hydroxylation at the pyrimidine ring is a
characteristic degradation reaction yielding
5-hydroxyamidosulfuron. |
| | Amidosulfuron Preparation Products And Raw materials |
|