| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,3,4,5-Tetrahydro-1H-benzo[b]azepine Basic information |
| Product Name: | 2,3,4,5-Tetrahydro-1H-benzo[b]azepine | | Synonyms: | 2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPINE;2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPINE HYDROCHLORIDE;2,3,4,5-Tetrahydro-1H-benzo[b]azepin;1H-1-Benzazepine, 2,3,4,5-tetrahydro-;5-Tetrahydro-1H-benzo[b]azepine | | CAS: | 1701-57-1 | | MF: | C10H13N | | MW: | 147.22 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 1701-57-1.mol | ![2,3,4,5-Tetrahydro-1H-benzo[b]azepine Structure](CAS/GIF/1701-57-1.gif) |
| | 2,3,4,5-Tetrahydro-1H-benzo[b]azepine Chemical Properties |
| Melting point | 32 °C | | Boiling point | 253-255 °C | | density | 1.03250061035156 g/cm3 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 5.22±0.20(Predicted) | | Appearance | White to light brown Solid | | InChI | InChI=1S/C10H13N/c1-2-7-10-9(5-1)6-3-4-8-11-10/h1-2,5,7,11H,3-4,6,8H2 | | InChIKey | MZBVNYACSSGXID-UHFFFAOYSA-N | | SMILES | N1C2=CC=CC=C2CCCC1 | | CAS DataBase Reference | 1701-57-1(CAS DataBase Reference) |
| | 2,3,4,5-Tetrahydro-1H-benzo[b]azepine Usage And Synthesis |
| Uses | 2,3,4,5-Tetrahydro-1H-1-benzazepine is a reactant in the synthesis of adamantane derivatives as cannabinoid receptor 2 agonists. |
| | 2,3,4,5-Tetrahydro-1H-benzo[b]azepine Preparation Products And Raw materials |
| Raw materials | 3-Methyl-3,4-dihydro-1H-quinolin-2-one-->Ethanone, 1-(2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl)--->Naphthalene, 1-azido-1,2,3,4-tetrahydro--->Benzenebutanol, 2-amino--->2-Chloro-benzenebutanamine-->3-Methyl-1,2,3,4-tetrahydroquinoline-->1,3,4,5-Tetrahydro-2H-1-benzazepin-2-one-->1,2,3,4-Tetrahydro-benzo[b]azepin-5-one-->Water-->carbon monoxide-->Benzenamine, 2-(2-propenyl)--->1,2,3,4-Tetrahydro-1-naphthol |
|