|
|
| Product Name: | 3-Amino-2-hydroxyacetophenone | | Synonyms: | 3-Amino-2-Hydroxy Acetophenone 3'-Amino-2'-Hydroxy Acetophenone;Ethanone, 1-(3-amino-2-hydroxyphenyl)- (9CI);3amino-2hydroxyacetophenone (intermediate of pranlukast);3-Amino-2-hydroxyacetophenone;2'-Hydroxy-3'-aminoacetophenone;1-(3-aMinophenyl)-2-hydroxyethan-1-one;Ethanone, 1-(3-aMino-2-hydroxyphenyl)-;3'-Amino-2'-hydroxyacetophenone
(Pranlukast) | | CAS: | 70977-72-9 | | MF: | C8H9NO2 | | MW: | 151.16 | | EINECS: | 676-239-5 | | Product Categories: | (intermediate of pranlukast);ACETYLGROUP;70977-72-9 | | Mol File: | 70977-72-9.mol |  |
| | 3-Amino-2-hydroxyacetophenone Chemical Properties |
| Melting point | 95-96 °C | | Boiling point | 287.2±25.0 °C(Predicted) | | density | 1.242±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 9.95±0.10(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C8H9NO2/c1-5(10)6-3-2-4-7(9)8(6)11/h2-4,11H,9H2,1H3 | | InChIKey | NLLYXOVHEQVWJF-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=CC(N)=C1O)C | | CAS DataBase Reference | 70977-72-9 |
| | 3-Amino-2-hydroxyacetophenone Usage And Synthesis |
| Uses | 3-Amino-2-hydroxyacetophenone is an important intermediate in the synthesis of profenofosil, and its synthesis has significant application value in the research of new drugs. | | Application | 3-Amino-2-hydroxyacetophenone is an organic synthesis intermediate and a pharmaceutical intermediate that can be used in laboratory research and development processes and chemical production processes. | | Chemical Properties | Yellow crystalline powder | | Preparation | Also obtained by bioconversion of nitro precursor using recombinant Escherichia coli strains. |
| | 3-Amino-2-hydroxyacetophenone Preparation Products And Raw materials |
|