| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Dimethylphenylphosphine Basic information |
| | Dimethylphenylphosphine Chemical Properties |
| Melting point | 126-127℃ | | Boiling point | 74-75 °C12 mm Hg(lit.) | | density | 0.971 g/mL at 25 °C(lit.) | | vapor pressure | 11 mm Hg ( 68 °C) | | refractive index | n20/D 1.563(lit.) | | Fp | 122 °F | | storage temp. | Flammables area | | solubility | Soluble in organic solvents. | | form | Liquid | | Specific Gravity | 0.967 | | color | Clear colorless | | Sensitive | Air Sensitive | | BRN | 742064 | | InChI | InChI=1S/C8H11P/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3 | | InChIKey | HASCQPSFPAKVEK-UHFFFAOYSA-N | | SMILES | P(C)(C)C1=CC=CC=C1 | | CAS DataBase Reference | 672-66-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36-16 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | F | 1-13 | | TSCA | No | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 29319090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | Dimethylphenylphosphine Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | Dimethylphenylphosphine is used as a ligand in transition metal complexes. | | Definition | ChEBI: Dimethyl(phenyl)phosphine is a tertiary phosphine. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | Dimethylphenylphosphine Preparation Products And Raw materials |
|