|
|
| | 4-Amino-3-hydroxybenzoic acid Basic information |
| | 4-Amino-3-hydroxybenzoic acid Chemical Properties |
| Melting point | 211-215 °C (lit.) | | Boiling point | 385.7±37.0 °C(Predicted) | | density | 1.028 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | pka | 4.74±0.10(Predicted) | | color | Yellow-brown to brown | | Water Solubility | Soluble in chloroform, and aqeous ethanol, water (Partly miscible) | | BRN | 509859 | | Major Application | peptide synthesis | | InChI | InChI=1S/C7H7NO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,8H2,(H,10,11) | | InChIKey | NFPYJDZQOKCYIE-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(N)C(O)=C1 | | CAS DataBase Reference | 2374-03-0(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Amino-3-hydroxybenzoic acid Usage And Synthesis |
| Chemical Properties | yellow-brown to brown crystalline powder | | Uses | 4-Amino-3-hydroxybenzoic Acid is disubsituted benzoic acid used in the preparation of various pharmaceutical compounds such as sphingosine kinase inhibitors. | | Uses | 4-Amino-3-hydroxybenzoic acid is used in the preparation of various pharmaceutical compounds such as sphingosine kinase inhibitors. | | reaction suitability | reaction type: solution phase peptide synthesis | | Synthesis | Step 1: Preparation of 3-hydroxy-4-nitrobenzoic acid (Compound 4A) 3-Hydroxybenzoic acid (220 mg, 1.6 mmol) was dissolved in acetonitrile, and after complete dissolution, ceric ammonium nitrate (1.26 g, 2.3 mmol) was added slowly in batches and stirred at room temperature overnight. The reaction was quenched with water at the end of the reaction, extracted with ethyl acetate, the organic terms were combined, dried, concentrated under reduced pressure and then chromatographed on a column (eluting with ethyl acetate) to obtain the solid product Compound 4A (85 mg, 27% yield). Step 2, the preparation of 4-amino-3-hydroxybenzoic acid (compound 4B) Compound 4A (85 mg, 0.8 mmol) was dissolved in methanol, Pd/C catalyst was added and then reacted at room temperature under the protection of hydrogen overnight, at the end of the reaction, the insoluble solid was filtered to remove the solid, and the organic layer was concentrated under reduced pressure to obtain the solid was not purified and used directly for the next step of the reaction. |
| | 4-Amino-3-hydroxybenzoic acid Preparation Products And Raw materials |
|