| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
2-Methyl-3-oxo-pentanoic acid ethyl ester manufacturers
|
| | 2-Methyl-3-oxo-pentanoic acid ethyl ester Basic information |
| Product Name: | 2-Methyl-3-oxo-pentanoic acid ethyl ester | | Synonyms: | Inchi=1/C8H14o3/C1-4-7(9)6(3)8(10)11-5-2/H6H,4-5H2,1-3h;Pentanoic acid, 2-methyl-3-oxo-, ethyl ester;2-METHYL-3-OXO-PENTANOIC;ethyl (2S)-2-methyl-3-oxo-pentanoate;Ethyl 2-methyl-3-oxopentanoate;2-Methyl-3-oxo-pentanoic acid ethyl ester | | CAS: | 759-66-0 | | MF: | C8H14O3 | | MW: | 158.2 | | EINECS: | | | Product Categories: | | | Mol File: | 759-66-0.mol |  |
| | 2-Methyl-3-oxo-pentanoic acid ethyl ester Chemical Properties |
| Boiling point | 106 °C(Press: 15 Torr) | | density | 0.979±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 11.87±0.46(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | -06071° (C=0.7 g/100ml, CHCL3) |
| | 2-Methyl-3-oxo-pentanoic acid ethyl ester Usage And Synthesis |
| | 2-Methyl-3-oxo-pentanoic acid ethyl ester Preparation Products And Raw materials |
|