- 2,2',3,4',4-PENTABDE
-
- $388.00
-
2019-07-06
- CAS:182346-21-0
- Min. Order: 10KG
- Purity: 995
- Supply Ability: 10kg
- 2,2',3,4',4-PENTABDE
-
- $50000.00
-
2019-07-06
- CAS:182346-21-0
- Min. Order: 100KG
- Purity: 99%
- Supply Ability: 5kg
|
| | 2,2',3,4',4-PENTABDE Basic information |
| Product Name: | 2,2',3,4',4-PENTABDE | | Synonyms: | BDE NO 85;2,2',3,4',4-PENTABDE;2,2',3,4,4'-PENTABROMODIPHENYL ETER;2,2',3,4',4-PENTABROMODIPHENYL ETHER;PBDE 85;2,2’,3,4,4'Pentabromodiphenyl ether,50 ug/mL in Isooctane;bde no 85solution;22344PENTABROMINATEDDIPHENYLETHER | | CAS: | 182346-21-0 | | MF: | C12H5Br5O | | MW: | 564.69 | | EINECS: | 621-547-7 | | Product Categories: | | | Mol File: | 182346-21-0.mol |  |
| | 2,2',3,4',4-PENTABDE Chemical Properties |
| Melting point | 123-124 °C(Solv: ethyl ether (60-29-7)) | | Boiling point | 439.3±45.0 °C(Predicted) | | density | 2.343±0.06 g/cm3(Predicted) | | Fp | -12 °C | | storage temp. | 2-8°C | | Henry's Law Constant | 9.1×100 mol/(m3Pa) at 25℃, Tittlemier et al. (2002) | | Major Application | environmental | | InChI | InChI=1S/C12H5Br5O/c13-6-1-3-9(8(15)5-6)18-10-4-2-7(14)11(16)12(10)17/h1-5H | | InChIKey | DMLQSUZPTTUUDP-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(OC2=CC=C(Br)C=C2Br)C(Br)=C1Br | | EPA Substance Registry System | Benzene, 1,2,3-tribromo-4-(2,4-dibromophenoxy)- (182346-21-0) |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-50/53-65-67 | | Safety Statements | 60-61-62-33-29-16-9 | | RIDADR | UN 1262 3/PG 2 | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Asp. Tox. 1
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,2',3,4',4-PENTABDE Usage And Synthesis |
| Uses | BDE 85 is a polybrominated di-phenyl ether (PBDE) that is used as flame retardant in plastics and textile materials. It can be found in the adipose tissue, plasma, and human milk. | | Definition | ChEBI: 2,4-dibromophenyl 2,3,4-tribromophenyl ether is a polybromodiphenyl ether that is diphenyl ether in which the hydrogens at the 2, 3, 4, 2', and 4' positions have been replaced by bromines. |
| | 2,2',3,4',4-PENTABDE Preparation Products And Raw materials |
|