|
|
| | 2,3',4,4',6-Pentabromodiphenyl ether Basic information |
| Product Name: | 2,3',4,4',6-Pentabromodiphenyl ether | | Synonyms: | PBDE 119;2,3',4,4',6-PENTABDE;BDE NO 119;bde no 119solution;2,3μ,4,4μ,6-PentaBDE, 2,3μ,4,4μ,6-Pentabromodiphenyl ether solution, PBDE 119;1,3,5-Tribromo-2-(3,4-dibromophenoxy)benzene;BDE 119;2,3',4,4',6-Pentabromodiphenyl ether (BDE-119) Solution | | CAS: | 189084-66-0 | | MF: | C12H5Br5O | | MW: | 564.69 | | EINECS: | 620-889-4 | | Product Categories: | | | Mol File: | 189084-66-0.mol |  |
| | 2,3',4,4',6-Pentabromodiphenyl ether Chemical Properties |
| Boiling point | 433.9±45.0 °C(Predicted) | | density | 2.343±0.06 g/cm3(Predicted) | | Fp | -12 °C | | storage temp. | 2-8°C | | Henry's Law Constant | 1.8×100 mol/(m3Pa) at 25℃, Long et al. (2017) | | Major Application | environmental | | InChI | 1S/C12H5Br5O/c13-6-3-10(16)12(11(17)4-6)18-7-1-2-8(14)9(15)5-7/h1-5H | | InChIKey | KXEOYBYEJCRPGB-UHFFFAOYSA-N | | SMILES | Brc1cc(Br)c(Oc2ccc(Br)c(Br)c2)c(Br)c1 | | EPA Substance Registry System | PBDE 119 (189084-66-0) |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-50/53-65-67 | | Safety Statements | 60-61-62-33-29-16-9 | | RIDADR | UN 1262 3/PG 2 | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3',4,4',6-Pentabromodiphenyl ether Usage And Synthesis |
| Uses | PBDE 119 is a polybrominated di-Ph ether (PBDE), which is a flame retardant often incorporated into many polymers. PBDEs are an environmental pollutant that exhibits potential health risks to humans and wildlife. |
| | 2,3',4,4',6-Pentabromodiphenyl ether Preparation Products And Raw materials |
|