| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (R)-(+)-N-(1-Phenylethyl)maleimide Basic information |
| | (R)-(+)-N-(1-Phenylethyl)maleimide Chemical Properties |
| Boiling point | 110-115 °C/0.004 mmHg (lit.) | | density | 1.138 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.556(lit.) | | Fp | 113 °C | | pka | -2.37±0.20(Predicted) | | Optical Rotation | [α]24/D +61°, c = 2 in ethanol | | InChI | 1S/C12H11NO2/c1-9(10-5-3-2-4-6-10)13-11(14)7-8-12(13)15/h2-9H,1H3/t9-/m1/s1 | | InChIKey | PWZXUQWQRVKGAH-SECBINFHSA-N | | SMILES | C[C@@H](N1C(=O)C=CC1=O)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-(+)-N-(1-Phenylethyl)maleimide Usage And Synthesis |
| Uses | This optically active maleimide undergoes radical copolymerization with styrene to yield a ~1:1 copolymer (~98%). Vinyl copolymers with asymmetric main chains can be used as nonlinear optical materials. Dienophile for diastereoselective Diels-Alder reactions. |
| | (R)-(+)-N-(1-Phenylethyl)maleimide Preparation Products And Raw materials |
|