| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- SATP
-
- $6.60
-
2019-12-27
- CAS: 84271-78-3
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| Product Name: | SATP | | Synonyms: | N-SUCCINIMIDYL 3-(ACETYLTHIO)PROPIONATE;N-SUCCINIMIDYL-S-ACETYLTHIOPROPIONATE;S-ACETYL-3-MERCAPTOPROPIONIC ACID-N-HYDROXYSUCCINIMIDE ESTER;SATP;3-ACETYLSULFANYL-PROPIONIC ACID-OSU;(2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate;3-(acetylthio)propionic acid n-succinimidyl ester;Acetic 2-(2,5-dioxopyrrolidin-1-yl)propanoic thioanhydride | | CAS: | 84271-78-3 | | MF: | C9H11NO5S | | MW: | 245.25 | | EINECS: | | | Product Categories: | Heterocycles;MTS & Sulfhydryl Active Reagents;MTS and Sulfhydryl Active Reagents | | Mol File: | 84271-78-3.mol |  |
| Melting point | 48-50°C | | Boiling point | 366.1±44.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform, Ethyl Acetate | | form | Solid | | color | Beige | | BRN | 5562810 | | InChI | InChI=1S/C9H11NO5S/c1-6(11)16-5-4-9(14)15-10-7(12)2-3-8(10)13/h2-5H2,1H3 | | InChIKey | ZRTJVRDXVSDKPX-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCSC(C)=O |
| WGK Germany | 3 | | F | 1-3-10 | | HS Code | 2930.90.9250 | | Storage Class | 13 - Non Combustible Solids |
| Chemical Properties | Beige Solid | | Uses | Reacts with primary amines to add protected sulfhydryls. | | Uses | 3-(Acetylthio)propionic acid N-succinimidyl ester may be used in oligosaccharide synthesis. It was used in binding antibody and ligand to atomic force microscope tips. | | General Description | 3-(Acetylthio)propionic acid N-succinimidyl ester causes tip functionalization and surface modification of antibody on atomic force microscope tips . |
| | SATP Preparation Products And Raw materials |
|